C18H16O7 — CID 175310617
3-(2,4-dihydroxyphenyl)prop-2-enoic acid;3-(4-hydroxyphenyl)prop-2-enoic acid (PubChem CID 175310617) has the molecular formula C18H16O7 and a molecular weight of 344.32 g/mol. Its IUPAC name is 3-(2,4-dihydroxyphenyl)prop-2-enoic acid;3-(4-hydroxyphenyl)prop-2-enoic acid.
| Compound Name | 3-(2,4-dihydroxyphenyl)prop-2-enoic acid;3-(4-hydroxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 175310617 |
| Molecular Formula | C18H16O7 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 3-(2,4-dihydroxyphenyl)prop-2-enoic acid;3-(4-hydroxyphenyl)prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(O)cc1.O=C(O)C=Cc1ccc(O)cc1O |
| InChI | InChI=1S/C9H8O4.C9H8O3/c10-7-3-1-6(8(11)5-7)2-4-9(12)13;10-8-4-1-7(2-5-8)3-6-9(11)12/h1-5,10-11H,(H,12,13);1-6,10H,(H,11,12) |
| InChIKey | SYFFOIANPAYENH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|