C18H14O6 — CID 73319213
3-[3-[5-(2-carboxyethenyl)-2-hydroxyphenyl]-4-hydroxyphenyl]prop-2-enoic acid (PubChem CID 73319213) has the molecular formula C18H14O6 and a molecular weight of 326.30 g/mol. Its IUPAC name is 3-[3-[5-(2-carboxyethenyl)-2-hydroxyphenyl]-4-hydroxyphenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[5-(2-carboxyethenyl)-2-hydroxyphenyl]-4-hydroxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 73319213 |
| Molecular Formula | C18H14O6 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 3-[3-[5-(2-carboxyethenyl)-2-hydroxyphenyl]-4-hydroxyphenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(O)c(-c2cc(C=CC(=O)O)ccc2O)c1 |
| InChI | InChI=1S/C18H14O6/c19-15-5-1-11(3-7-17(21)22)9-13(15)14-10-12(2-6-16(14)20)4-8-18(23)24/h1-10,19-20H,(H,21,22)(H,23,24) |
| InChIKey | BAAOJOIKEMMQAG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|