C10H13NO4 — CID 25050146
azane;(Z)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid (PubChem CID 25050146) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is azane;(Z)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid.
| Compound Name | azane;(Z)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 25050146 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | azane;(Z)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid |
| SMILES | COc1cc(/C=C\C(=O)O)ccc1O.N |
| InChI | InChI=1S/C10H10O4.H3N/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13;/h2-6,11H,1H3,(H,12,13);1H3/b5-3-; |
| InChIKey | CHIVDOLFXAKMDO-FBZPGIPVSA-N |
| XLogP | 1.66 |
| TPSA | 101.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|