C17H17NO5 — CID 174791707
benzamide;3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid (PubChem CID 174791707) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is benzamide;3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid.
| Compound Name | benzamide;3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 174791707 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | benzamide;3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid |
| SMILES | COc1cc(C=CC(=O)O)ccc1O.NC(=O)c1ccccc1 |
| InChI | InChI=1S/C10H10O4.C7H7NO/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13;8-7(9)6-4-2-1-3-5-6/h2-6,11H,1H3,(H,12,13);1-5H,(H2,8,9) |
| InChIKey | FLJCZMRSBJNBND-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|