C27H26O6 — CID 174945129
benzene;(1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 174945129) has the molecular formula C27H26O6 and a molecular weight of 446.50 g/mol. Its IUPAC name is benzene;(1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | benzene;(1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 174945129 |
| Molecular Formula | C27H26O6 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | benzene;(1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(O)c(OC)c2)ccc1O.c1ccccc1 |
| InChI | InChI=1S/C21H20O6.C6H6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2;1-2-4-6-5-3-1/h3-12,24-25H,13H2,1-2H3;1-6H/b7-3+,8-4+; |
| InChIKey | INJFUAZGPQTLDJ-UQXJJJGTSA-N |
| XLogP | 5.06 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|