C22H22O5 — CID 126583439
(1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)-5-methylidenehepta-1,6-dien-3-one (PubChem CID 126583439) has the molecular formula C22H22O5 and a molecular weight of 366.41 g/mol. Its IUPAC name is (1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)-5-methylidenehepta-1,6-dien-3-one.
| Compound Name | (1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)-5-methylidenehepta-1,6-dien-3-one |
|---|---|
| PubChem CID | 126583439 |
| Molecular Formula | C22H22O5 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | (1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)-5-methylidenehepta-1,6-dien-3-one |
| SMILES | C=C(/C=C/c1ccc(O)c(OC)c1)CC(=O)/C=C/c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C22H22O5/c1-15(4-5-16-7-10-19(24)21(13-16)26-2)12-18(23)9-6-17-8-11-20(25)22(14-17)27-3/h4-11,13-14,24-25H,1,12H2,2-3H3/b5-4+,9-6+ |
| InChIKey | JSDJGRHCEMSYIX-HSKKLARCSA-N |
| XLogP | 4.36 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|