C25H23NO8 — CID 174756589
(1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione;2-cyanoprop-2-enoic acid (PubChem CID 174756589) has the molecular formula C25H23NO8 and a molecular weight of 465.46 g/mol. Its IUPAC name is (1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione;2-cyanoprop-2-enoic acid.
| Compound Name | (1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione;2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 174756589 |
| Molecular Formula | C25H23NO8 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | (1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione;2-cyanoprop-2-enoic acid |
| SMILES | C=C(C#N)C(=O)O.COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C21H20O6.C4H3NO2/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2;1-3(2-5)4(6)7/h3-12,24-25H,13H2,1-2H3;1H2,(H,6,7)/b7-3+,8-4+; |
| InChIKey | UTUMVTWCYUHUJL-UQXJJJGTSA-N |
| XLogP | 3.52 |
| TPSA | 154.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|