C21H22BO8 — CID 174827534
CID 174827534 (PubChem CID 174827534) has the molecular formula C21H22BO8 and a molecular weight of 413.21 g/mol.
| Compound Name | CID 174827534 |
|---|---|
| PubChem CID | 174827534 |
| Molecular Formula | C21H22BO8 |
| Molecular Weight | 413.21 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | — |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(O)c(OC)c2)ccc1O.O[B]O |
| InChI | InChI=1S/C21H20O6.BH2O2/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2;2-1-3/h3-12,24-25H,13H2,1-2H3;2-3H/b7-3+,8-4+; |
| InChIKey | MDFLYYUXKVMELH-UQXJJJGTSA-N |
| XLogP | 1.88 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|