C29H30O10 — CID 161331939
(E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid;(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid;2-methoxy-4-[(E)-prop-1-enyl]phenol (PubChem CID 161331939) has the molecular formula C29H30O10 and a molecular weight of 538.55 g/mol. Its IUPAC name is (E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid;(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid;2-methoxy-4-[(E)-prop-1-enyl]phenol.
| Compound Name | (E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid;(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid;2-methoxy-4-[(E)-prop-1-enyl]phenol |
|---|---|
| PubChem CID | 161331939 |
| Molecular Formula | C29H30O10 |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | (E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid;(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid;2-methoxy-4-[(E)-prop-1-enyl]phenol |
| SMILES | C/C=C/c1ccc(O)c(OC)c1.COc1cc(/C=C/C(=O)O)ccc1O.O=C(O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C10H10O4.C10H12O2.C9H8O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13;1-3-4-8-5-6-9(11)10(7-8)12-2;10-7-3-1-6(5-8(7)11)2-4-9(12)13/h2-6,11H,1H3,(H,12,13);3-7,11H,1-2H3;1-5,10-11H,(H,12,13)/b5-3+;4-3+;4-2+ |
| InChIKey | VLNLRKPYJYKBAC-ZLLYEQSASA-N |
| XLogP | 5.13 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|