C12H12O4 — CID 14053117
(2E,4E)-5-(4-hydroxy-3-methoxyphenyl)penta-2,4-dienoic acid (PubChem CID 14053117) has the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. Its IUPAC name is (2E,4E)-5-(4-hydroxy-3-methoxyphenyl)penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-(4-hydroxy-3-methoxyphenyl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 14053117 |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | (2E,4E)-5-(4-hydroxy-3-methoxyphenyl)penta-2,4-dienoic acid |
| SMILES | COc1cc(/C=C/C=C/C(=O)O)ccc1O |
| InChI | InChI=1S/C12H12O4/c1-16-11-8-9(6-7-10(11)13)4-2-3-5-12(14)15/h2-8,13H,1H3,(H,14,15)/b4-2+,5-3+ |
| InChIKey | PZTHQMWVDHEWPY-ZUVMSYQZSA-N |
| XLogP | 2.05 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|