C19H20O4 — CID 87643823
4-[(1E,3E)-4-(3,4-dimethoxyphenyl)buta-1,3-dienyl]-2-methoxyphenol (PubChem CID 87643823) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is 4-[(1E,3E)-4-(3,4-dimethoxyphenyl)buta-1,3-dienyl]-2-methoxyphenol.
| Compound Name | 4-[(1E,3E)-4-(3,4-dimethoxyphenyl)buta-1,3-dienyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 87643823 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 4-[(1E,3E)-4-(3,4-dimethoxyphenyl)buta-1,3-dienyl]-2-methoxyphenol |
| SMILES | COc1cc(/C=C/C=C/c2ccc(OC)c(OC)c2)ccc1O |
| InChI | InChI=1S/C19H20O4/c1-21-17-11-9-15(13-19(17)23-3)7-5-4-6-14-8-10-16(20)18(12-14)22-2/h4-13,20H,1-3H3/b6-4+,7-5+ |
| InChIKey | QHTVMKSATYXVEP-YDFGWWAZSA-N |
| XLogP | 4.14 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|