C13H14O3 — CID 12514233
(2E,4E)-5-(3,4-dimethoxyphenyl)penta-2,4-dienal (PubChem CID 12514233) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is (2E,4E)-5-(3,4-dimethoxyphenyl)penta-2,4-dienal.
| Compound Name | (2E,4E)-5-(3,4-dimethoxyphenyl)penta-2,4-dienal |
|---|---|
| PubChem CID | 12514233 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (2E,4E)-5-(3,4-dimethoxyphenyl)penta-2,4-dienal |
| SMILES | COc1ccc(/C=C/C=C/C=O)cc1OC |
| InChI | InChI=1S/C13H14O3/c1-15-12-8-7-11(10-13(12)16-2)6-4-3-5-9-14/h3-10H,1-2H3/b5-3+,6-4+ |
| InChIKey | DWRJGLPEOLVRQC-GGWOSOGESA-N |
| XLogP | 2.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|