C23H28O5 — CID 143217008
(1E,4E)-1,5-bis(3,4-dimethoxyphenyl)penta-1,4-dien-3-one;ethane (PubChem CID 143217008) has the molecular formula C23H28O5 and a molecular weight of 384.47 g/mol. Its IUPAC name is (1E,4E)-1,5-bis(3,4-dimethoxyphenyl)penta-1,4-dien-3-one;ethane.
| Compound Name | (1E,4E)-1,5-bis(3,4-dimethoxyphenyl)penta-1,4-dien-3-one;ethane |
|---|---|
| PubChem CID | 143217008 |
| Molecular Formula | C23H28O5 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | (1E,4E)-1,5-bis(3,4-dimethoxyphenyl)penta-1,4-dien-3-one;ethane |
| SMILES | CC.COc1ccc(/C=C/C(=O)/C=C/c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C21H22O5.C2H6/c1-23-18-11-7-15(13-20(18)25-3)5-9-17(22)10-6-16-8-12-19(24-2)21(14-16)26-4;1-2/h5-14H,1-4H3;1-2H3/b9-5+,10-6+; |
| InChIKey | CTUQPCSXKJRYDI-QJQFWQJTSA-N |
| XLogP | 5.04 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|