C15H18O4 — CID 68770825
7-(3,4-dimethoxyphenyl)hept-6-ene-2,5-dione (PubChem CID 68770825) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is 7-(3,4-dimethoxyphenyl)hept-6-ene-2,5-dione.
| Compound Name | 7-(3,4-dimethoxyphenyl)hept-6-ene-2,5-dione |
|---|---|
| PubChem CID | 68770825 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 7-(3,4-dimethoxyphenyl)hept-6-ene-2,5-dione |
| SMILES | COc1ccc(C=CC(=O)CCC(C)=O)cc1OC |
| InChI | InChI=1S/C15H18O4/c1-11(16)4-7-13(17)8-5-12-6-9-14(18-2)15(10-12)19-3/h5-6,8-10H,4,7H2,1-3H3 |
| InChIKey | KCQNNJGJUHEQHD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|