C23H24O6 — CID 123914659
1,7-bis[3,4-bis(trideuteriomethoxy)phenyl]hepta-1,6-diene-3,5-dione (PubChem CID 123914659) has the molecular formula C23H24O6 and a molecular weight of 408.51 g/mol. Its IUPAC name is 1,7-bis[3,4-bis(trideuteriomethoxy)phenyl]hepta-1,6-diene-3,5-dione.
| Compound Name | 1,7-bis[3,4-bis(trideuteriomethoxy)phenyl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 123914659 |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 1,7-bis[3,4-bis(trideuteriomethoxy)phenyl]hepta-1,6-diene-3,5-dione |
| SMILES | [2H]C([2H])([2H])Oc1ccc(C=CC(=O)CC(=O)C=Cc2ccc(OC([2H])([2H])[2H])c(OC([2H])([2H])[2H])c2)cc1OC([2H])([2H])[2H] |
| InChI | InChI=1S/C23H24O6/c1-26-20-11-7-16(13-22(20)28-3)5-9-18(24)15-19(25)10-6-17-8-12-21(27-2)23(14-17)29-4/h5-14H,15H2,1-4H3/i1D3,2D3,3D3,4D3 |
| InChIKey | HMJSBVCDPKODEX-MGKWXGLJSA-N |
| XLogP | 3.98 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|