C23H23BF2O6 — CID 156597810
(1E,4Z,6E)-1,7-bis[3,4-bis(trideuteriomethoxy)phenyl]-5-difluoroboranyloxyhepta-1,4,6-trien-3-one (PubChem CID 156597810) has the molecular formula C23H23BF2O6 and a molecular weight of 456.31 g/mol. Its IUPAC name is (1E,4Z,6E)-1,7-bis[3,4-bis(trideuteriomethoxy)phenyl]-5-difluoroboranyloxyhepta-1,4,6-trien-3-one.
| Compound Name | (1E,4Z,6E)-1,7-bis[3,4-bis(trideuteriomethoxy)phenyl]-5-difluoroboranyloxyhepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 156597810 |
| Molecular Formula | C23H23BF2O6 |
| Molecular Weight | 456.31 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | (1E,4Z,6E)-1,7-bis[3,4-bis(trideuteriomethoxy)phenyl]-5-difluoroboranyloxyhepta-1,4,6-trien-3-one |
| SMILES | [2H]C([2H])([2H])Oc1ccc(/C=C/C(=O)/C=C(/C=C/c2ccc(OC([2H])([2H])[2H])c(OC([2H])([2H])[2H])c2)OB(F)F)cc1OC([2H])([2H])[2H] |
| InChI | InChI=1S/C23H23BF2O6/c1-28-20-11-7-16(13-22(20)30-3)5-9-18(27)15-19(32-24(25)26)10-6-17-8-12-21(29-2)23(14-17)31-4/h5-15H,1-4H3/b9-5+,10-6+,19-15-/i1D3,2D3,3D3,4D3 |
| InChIKey | UZTIGZPRNGJKDS-OOWDHBBMSA-N |
| XLogP | 4.84 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.31 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|