C15H16O4 — CID 175414415
1-(3,4-dimethoxyphenyl)-5-hydroxyhepta-1,4,6-trien-3-one (PubChem CID 175414415) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-5-hydroxyhepta-1,4,6-trien-3-one.
| Compound Name | 1-(3,4-dimethoxyphenyl)-5-hydroxyhepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 175414415 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-5-hydroxyhepta-1,4,6-trien-3-one |
| SMILES | C=CC(O)=CC(=O)C=Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H16O4/c1-4-12(16)10-13(17)7-5-11-6-8-14(18-2)15(9-11)19-3/h4-10,16H,1H2,2-3H3 |
| InChIKey | XYPIDOFSNZWFKF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|