C27H28O10 — CID 10414053
methyl 2-[4-[(1E,3Z,6E)-3-hydroxy-7-[3-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]-5-oxohepta-1,3,6-trienyl]-2-methoxyphenoxy]acetate (PubChem CID 10414053) has the molecular formula C27H28O10 and a molecular weight of 512.51 g/mol. Its IUPAC name is methyl 2-[4-[(1E,3Z,6E)-3-hydroxy-7-[3-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]-5-oxohepta-1,3,6-trienyl]-2-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[(1E,3Z,6E)-3-hydroxy-7-[3-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]-5-oxohepta-1,3,6-trienyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 10414053 |
| Molecular Formula | C27H28O10 |
| Molecular Weight | 512.51 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | methyl 2-[4-[(1E,3Z,6E)-3-hydroxy-7-[3-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]-5-oxohepta-1,3,6-trienyl]-2-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1ccc(/C=C/C(=O)/C=C(O)/C=C/c2ccc(OCC(=O)OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C27H28O10/c1-32-24-13-18(7-11-22(24)36-16-26(30)34-3)5-9-20(28)15-21(29)10-6-19-8-12-23(25(14-19)33-2)37-17-27(31)35-4/h5-15,28H,16-17H2,1-4H3/b9-5+,10-6+,20-15- |
| InChIKey | LXBNYFILNHOWEE-OEHUVLJNSA-N |
| XLogP | 3.55 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|