C24H25FO6 — CID 53483993
(1E,4Z,6E)-7-(3,4-dimethoxyphenyl)-1-[4-(2-fluoroethoxy)-3-methoxyphenyl]-5-hydroxyhepta-1,4,6-trien-3-one (PubChem CID 53483993) has the molecular formula C24H25FO6 and a molecular weight of 428.46 g/mol. Its IUPAC name is (1E,4Z,6E)-7-(3,4-dimethoxyphenyl)-1-[4-(2-fluoroethoxy)-3-methoxyphenyl]-5-hydroxyhepta-1,4,6-trien-3-one.
| Compound Name | (1E,4Z,6E)-7-(3,4-dimethoxyphenyl)-1-[4-(2-fluoroethoxy)-3-methoxyphenyl]-5-hydroxyhepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 53483993 |
| Molecular Formula | C24H25FO6 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | (1E,4Z,6E)-7-(3,4-dimethoxyphenyl)-1-[4-(2-fluoroethoxy)-3-methoxyphenyl]-5-hydroxyhepta-1,4,6-trien-3-one |
| SMILES | COc1ccc(/C=C/C(O)=C/C(=O)/C=C/c2ccc(OCCF)c(OC)c2)cc1OC |
| InChI | InChI=1S/C24H25FO6/c1-28-21-10-6-17(14-23(21)29-2)4-8-19(26)16-20(27)9-5-18-7-11-22(31-13-12-25)24(15-18)30-3/h4-11,14-16,26H,12-13H2,1-3H3/b8-4+,9-5+,19-16- |
| InChIKey | WBJUIDYLBORUSP-LZUKJIRESA-N |
| XLogP | 4.80 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|