C27H24O6 — CID 173379897
(1E,6E)-5-hydroxy-1,7-bis(3-methoxy-4-prop-2-ynoxyphenyl)hepta-1,4,6-trien-3-one (PubChem CID 173379897) has the molecular formula C27H24O6 and a molecular weight of 444.48 g/mol. Its IUPAC name is (1E,6E)-5-hydroxy-1,7-bis(3-methoxy-4-prop-2-ynoxyphenyl)hepta-1,4,6-trien-3-one.
| Compound Name | (1E,6E)-5-hydroxy-1,7-bis(3-methoxy-4-prop-2-ynoxyphenyl)hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 173379897 |
| Molecular Formula | C27H24O6 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | (1E,6E)-5-hydroxy-1,7-bis(3-methoxy-4-prop-2-ynoxyphenyl)hepta-1,4,6-trien-3-one |
| SMILES | C#CCOc1ccc(/C=C/C(=O)C=C(O)/C=C/c2ccc(OCC#C)c(OC)c2)cc1OC |
| InChI | InChI=1S/C27H24O6/c1-5-15-32-24-13-9-20(17-26(24)30-3)7-11-22(28)19-23(29)12-8-21-10-14-25(33-16-6-2)27(18-21)31-4/h1-2,7-14,17-19,28H,15-16H2,3-4H3/b11-7+,12-8+,22-19? |
| InChIKey | VLQWKIHNQSOTCT-FRQAQMOBSA-N |
| XLogP | 4.47 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|