C37H32F2N2O8 — CID 122190253
2-[4-[(1E,3Z,6E)-7-[4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]-3-hydroxy-5-oxohepta-1,3,6-trienyl]-2-methoxyphenoxy]-N-(4-fluorophenyl)acetamide (PubChem CID 122190253) has the molecular formula C37H32F2N2O8 and a molecular weight of 670.67 g/mol. Its IUPAC name is 2-[4-[(1E,3Z,6E)-7-[4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]-3-hydroxy-5-oxohepta-1,3,6-trienyl]-2-methoxyphenoxy]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[4-[(1E,3Z,6E)-7-[4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]-3-hydroxy-5-oxohepta-1,3,6-trienyl]-2-methoxyphenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 122190253 |
| Molecular Formula | C37H32F2N2O8 |
| Molecular Weight | 670.67 g/mol |
| Exact Mass | 670.21 |
| IUPAC Name | 2-[4-[(1E,3Z,6E)-7-[4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]-3-hydroxy-5-oxohepta-1,3,6-trienyl]-2-methoxyphenoxy]-N-(4-fluorophenyl)acetamide |
| SMILES | COc1cc(/C=C/C(=O)/C=C(O)/C=C/c2ccc(OCC(=O)Nc3ccc(F)cc3)c(OC)c2)ccc1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C37H32F2N2O8/c1-46-34-19-24(5-17-32(34)48-22-36(44)40-28-11-7-26(38)8-12-28)3-15-30(42)21-31(43)16-4-25-6-18-33(35(20-25)47-2)49-23-37(45)41-29-13-9-27(39)10-14-29/h3-21,42H,22-23H2,1-2H3,(H,40,44)(H,41,45)/b15-3+,16-4+,30-21- |
| InChIKey | SGECKCLGAWNGLV-QKMBNCDZSA-N |
| XLogP | 6.75 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.67 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|