C17H16FNO5 — CID 28913369
N-(4-fluorophenyl)-2-(4-formyl-2,6-dimethoxyphenoxy)acetamide (PubChem CID 28913369) has the molecular formula C17H16FNO5 and a molecular weight of 333.32 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-(4-formyl-2,6-dimethoxyphenoxy)acetamide.
| Compound Name | N-(4-fluorophenyl)-2-(4-formyl-2,6-dimethoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 28913369 |
| Molecular Formula | C17H16FNO5 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | N-(4-fluorophenyl)-2-(4-formyl-2,6-dimethoxyphenoxy)acetamide |
| SMILES | COc1cc(C=O)cc(OC)c1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H16FNO5/c1-22-14-7-11(9-20)8-15(23-2)17(14)24-10-16(21)19-13-5-3-12(18)4-6-13/h3-9H,10H2,1-2H3,(H,19,21) |
| InChIKey | ARRYZJCRZCRMOI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|