C16H16FNO4 — CID 7612567
2-(2,6-dimethoxyphenoxy)-N-(3-fluorophenyl)acetamide (PubChem CID 7612567) has the molecular formula C16H16FNO4 and a molecular weight of 305.31 g/mol. Its IUPAC name is 2-(2,6-dimethoxyphenoxy)-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-(2,6-dimethoxyphenoxy)-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 7612567 |
| Molecular Formula | C16H16FNO4 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 2-(2,6-dimethoxyphenoxy)-N-(3-fluorophenyl)acetamide |
| SMILES | COc1cccc(OC)c1OCC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C16H16FNO4/c1-20-13-7-4-8-14(21-2)16(13)22-10-15(19)18-12-6-3-5-11(17)9-12/h3-9H,10H2,1-2H3,(H,18,19) |
| InChIKey | JGSCJIZKVRRTHY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |