C17H19FN2O4 — CID 51178406
N-(3-fluorophenyl)-2-(3,4,5-trimethoxyanilino)acetamide (PubChem CID 51178406) has the molecular formula C17H19FN2O4 and a molecular weight of 334.35 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-(3,4,5-trimethoxyanilino)acetamide.
| Compound Name | N-(3-fluorophenyl)-2-(3,4,5-trimethoxyanilino)acetamide |
|---|---|
| PubChem CID | 51178406 |
| Molecular Formula | C17H19FN2O4 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | N-(3-fluorophenyl)-2-(3,4,5-trimethoxyanilino)acetamide |
| SMILES | COc1cc(NCC(=O)Nc2cccc(F)c2)cc(OC)c1OC |
| InChI | InChI=1S/C17H19FN2O4/c1-22-14-8-13(9-15(23-2)17(14)24-3)19-10-16(21)20-12-6-4-5-11(18)7-12/h4-9,19H,10H2,1-3H3,(H,20,21) |
| InChIKey | VUQFESOSZLWNKA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|