C20H21FN2O5 — CID 108983639
1-N-(3-fluorophenyl)-1-N'-(3,4,5-trimethoxyphenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108983639) has the molecular formula C20H21FN2O5 and a molecular weight of 388.40 g/mol. Its IUPAC name is 1-N-(3-fluorophenyl)-1-N'-(3,4,5-trimethoxyphenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-(3-fluorophenyl)-1-N'-(3,4,5-trimethoxyphenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108983639 |
| Molecular Formula | C20H21FN2O5 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 1-N-(3-fluorophenyl)-1-N'-(3,4,5-trimethoxyphenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc(NC(=O)C2(C(=O)Nc3cccc(F)c3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C20H21FN2O5/c1-26-15-10-14(11-16(27-2)17(15)28-3)23-19(25)20(7-8-20)18(24)22-13-6-4-5-12(21)9-13/h4-6,9-11H,7-8H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | MNTXBMBRJGQIBU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|