C17H14BrFN2O2 — CID 108982934
1-N-(4-bromophenyl)-1-N'-(3-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108982934) has the molecular formula C17H14BrFN2O2 and a molecular weight of 377.21 g/mol. Its IUPAC name is 1-N-(4-bromophenyl)-1-N'-(3-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-(4-bromophenyl)-1-N'-(3-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108982934 |
| Molecular Formula | C17H14BrFN2O2 |
| Molecular Weight | 377.21 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 1-N-(4-bromophenyl)-1-N'-(3-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1)C1(C(=O)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C17H14BrFN2O2/c18-11-4-6-13(7-5-11)20-15(22)17(8-9-17)16(23)21-14-3-1-2-12(19)10-14/h1-7,10H,8-9H2,(H,20,22)(H,21,23) |
| InChIKey | GFEWQJWNUBLXJM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.21 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|