C16H21FN2O2 — CID 108979827
1-N'-(3-fluorophenyl)-1-N-pentylcyclopropane-1,1-dicarboxamide (PubChem CID 108979827) has the molecular formula C16H21FN2O2 and a molecular weight of 292.35 g/mol. Its IUPAC name is 1-N'-(3-fluorophenyl)-1-N-pentylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(3-fluorophenyl)-1-N-pentylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108979827 |
| Molecular Formula | C16H21FN2O2 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 1-N'-(3-fluorophenyl)-1-N-pentylcyclopropane-1,1-dicarboxamide |
| SMILES | CCCCCNC(=O)C1(C(=O)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C16H21FN2O2/c1-2-3-4-10-18-14(20)16(8-9-16)15(21)19-13-7-5-6-12(17)11-13/h5-7,11H,2-4,8-10H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | RCXHDRNYYBMTOX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|