C25H24FN3O4S — CID 156828632
1-N'-(3-fluorophenyl)-1-N-[4-(2-phenylethylsulfamoyl)phenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 156828632) has the molecular formula C25H24FN3O4S and a molecular weight of 481.55 g/mol. Its IUPAC name is 1-N'-(3-fluorophenyl)-1-N-[4-(2-phenylethylsulfamoyl)phenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(3-fluorophenyl)-1-N-[4-(2-phenylethylsulfamoyl)phenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 156828632 |
| Molecular Formula | C25H24FN3O4S |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 1-N'-(3-fluorophenyl)-1-N-[4-(2-phenylethylsulfamoyl)phenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NCCc2ccccc2)cc1)C1(C(=O)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C25H24FN3O4S/c26-19-7-4-8-21(17-19)29-24(31)25(14-15-25)23(30)28-20-9-11-22(12-10-20)34(32,33)27-16-13-18-5-2-1-3-6-18/h1-12,17,27H,13-16H2,(H,28,30)(H,29,31) |
| InChIKey | UVXGMNFIXIJDKZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|