C14H16FN3O2S — CID 43566343
N-[2-(3-fluorophenyl)ethyl]-4-hydrazinylbenzenesulfonamide (PubChem CID 43566343) has the molecular formula C14H16FN3O2S and a molecular weight of 309.37 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)ethyl]-4-hydrazinylbenzenesulfonamide.
| Compound Name | N-[2-(3-fluorophenyl)ethyl]-4-hydrazinylbenzenesulfonamide |
|---|---|
| PubChem CID | 43566343 |
| Molecular Formula | C14H16FN3O2S |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | N-[2-(3-fluorophenyl)ethyl]-4-hydrazinylbenzenesulfonamide |
| SMILES | NNc1ccc(S(=O)(=O)NCCc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C14H16FN3O2S/c15-12-3-1-2-11(10-12)8-9-17-21(19,20)14-6-4-13(18-16)5-7-14/h1-7,10,17-18H,8-9,16H2 |
| InChIKey | OJWUNPMGSBGZAA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|