C17H16F4N2O3S — CID 38257742
4-[2-(3-fluorophenyl)ethylsulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 38257742) has the molecular formula C17H16F4N2O3S and a molecular weight of 404.39 g/mol. Its IUPAC name is 4-[2-(3-fluorophenyl)ethylsulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[2-(3-fluorophenyl)ethylsulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 38257742 |
| Molecular Formula | C17H16F4N2O3S |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 4-[2-(3-fluorophenyl)ethylsulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(NCC(F)(F)F)c1ccc(S(=O)(=O)NCCc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C17H16F4N2O3S/c18-14-3-1-2-12(10-14)8-9-23-27(25,26)15-6-4-13(5-7-15)16(24)22-11-17(19,20)21/h1-7,10,23H,8-9,11H2,(H,22,24) |
| InChIKey | CKRGOULSTDJOFQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |