C13H19ClF3N3O3S — CID 119965025
4-[3-(methylamino)propylsulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide;hydrochloride (PubChem CID 119965025) has the molecular formula C13H19ClF3N3O3S and a molecular weight of 389.83 g/mol. Its IUPAC name is 4-[3-(methylamino)propylsulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide;hydrochloride.
| Compound Name | 4-[3-(methylamino)propylsulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119965025 |
| Molecular Formula | C13H19ClF3N3O3S |
| Molecular Weight | 389.83 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 4-[3-(methylamino)propylsulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide;hydrochloride |
| SMILES | CNCCCNS(=O)(=O)c1ccc(C(=O)NCC(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C13H18F3N3O3S.ClH/c1-17-7-2-8-19-23(21,22)11-5-3-10(4-6-11)12(20)18-9-13(14,15)16;/h3-6,17,19H,2,7-9H2,1H3,(H,18,20);1H |
| InChIKey | IBISXHNFHWYVRQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.83 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|