C11H10F3N3O3S — CID 9452221
4-(cyanomethylsulfamoyl)-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 9452221) has the molecular formula C11H10F3N3O3S and a molecular weight of 321.28 g/mol. Its IUPAC name is 4-(cyanomethylsulfamoyl)-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-(cyanomethylsulfamoyl)-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 9452221 |
| Molecular Formula | C11H10F3N3O3S |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 4-(cyanomethylsulfamoyl)-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | N#CCNS(=O)(=O)c1ccc(C(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H10F3N3O3S/c12-11(13,14)7-16-10(18)8-1-3-9(4-2-8)21(19,20)17-6-5-15/h1-4,17H,6-7H2,(H,16,18) |
| InChIKey | QRZPQSYSZBGERH-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|