C14H17F3N2O3S — CID 8817212
4-[[(1R)-1-cyclopropylethyl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 8817212) has the molecular formula C14H17F3N2O3S and a molecular weight of 350.36 g/mol. Its IUPAC name is 4-[[(1R)-1-cyclopropylethyl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[[(1R)-1-cyclopropylethyl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 8817212 |
| Molecular Formula | C14H17F3N2O3S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 4-[[(1R)-1-cyclopropylethyl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | C[C@@H](NS(=O)(=O)c1ccc(C(=O)NCC(F)(F)F)cc1)C1CC1 |
| InChI | InChI=1S/C14H17F3N2O3S/c1-9(10-2-3-10)19-23(21,22)12-6-4-11(5-7-12)13(20)18-8-14(15,16)17/h4-7,9-10,19H,2-3,8H2,1H3,(H,18,20)/t9-/m1/s1 |
| InChIKey | ICUGAIGQRLFLGB-SECBINFHSA-N |
| XLogP | 2.06 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |