C19H20F3N3O4S — CID 55492050
2-[[4-(propan-2-ylsulfamoyl)benzoyl]amino]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 55492050) has the molecular formula C19H20F3N3O4S and a molecular weight of 443.45 g/mol. Its IUPAC name is 2-[[4-(propan-2-ylsulfamoyl)benzoyl]amino]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-[[4-(propan-2-ylsulfamoyl)benzoyl]amino]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 55492050 |
| Molecular Formula | C19H20F3N3O4S |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 2-[[4-(propan-2-ylsulfamoyl)benzoyl]amino]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(C(=O)Nc2ccccc2C(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H20F3N3O4S/c1-12(2)25-30(28,29)14-9-7-13(8-10-14)17(26)24-16-6-4-3-5-15(16)18(27)23-11-19(20,21)22/h3-10,12,25H,11H2,1-2H3,(H,23,27)(H,24,26) |
| InChIKey | NJCFXAOIPARDLP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |