C18H20F3N3O5S2 — CID 55879590
3-[[4-(propan-2-ylsulfamoyl)phenyl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 55879590) has the molecular formula C18H20F3N3O5S2 and a molecular weight of 479.50 g/mol. Its IUPAC name is 3-[[4-(propan-2-ylsulfamoyl)phenyl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3-[[4-(propan-2-ylsulfamoyl)phenyl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 55879590 |
| Molecular Formula | C18H20F3N3O5S2 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 3-[[4-(propan-2-ylsulfamoyl)phenyl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(NS(=O)(=O)c2cccc(C(=O)NCC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H20F3N3O5S2/c1-12(2)23-30(26,27)15-8-6-14(7-9-15)24-31(28,29)16-5-3-4-13(10-16)17(25)22-11-18(19,20)21/h3-10,12,23-24H,11H2,1-2H3,(H,22,25) |
| InChIKey | JIPYXWSXZJUTQM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |