C18H24ClN3O3S — CID 119628934
N-(2-amino-2-methylpropyl)-3-[(4-methylphenyl)sulfamoyl]benzamide;hydrochloride (PubChem CID 119628934) has the molecular formula C18H24ClN3O3S and a molecular weight of 397.93 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-3-[(4-methylphenyl)sulfamoyl]benzamide;hydrochloride.
| Compound Name | N-(2-amino-2-methylpropyl)-3-[(4-methylphenyl)sulfamoyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119628934 |
| Molecular Formula | C18H24ClN3O3S |
| Molecular Weight | 397.93 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-3-[(4-methylphenyl)sulfamoyl]benzamide;hydrochloride |
| SMILES | Cc1ccc(NS(=O)(=O)c2cccc(C(=O)NCC(C)(C)N)c2)cc1.Cl |
| InChI | InChI=1S/C18H23N3O3S.ClH/c1-13-7-9-15(10-8-13)21-25(23,24)16-6-4-5-14(11-16)17(22)20-12-18(2,3)19;/h4-11,21H,12,19H2,1-3H3,(H,20,22);1H |
| InChIKey | PJLANLKLOPQCDZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.93 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |