C23H24N2O5S2 — CID 55948380
3-[(4-methylphenyl)sulfamoyl]-N-[[4-(methylsulfonylmethyl)phenyl]methyl]benzamide (PubChem CID 55948380) has the molecular formula C23H24N2O5S2 and a molecular weight of 472.59 g/mol. Its IUPAC name is 3-[(4-methylphenyl)sulfamoyl]-N-[[4-(methylsulfonylmethyl)phenyl]methyl]benzamide.
| Compound Name | 3-[(4-methylphenyl)sulfamoyl]-N-[[4-(methylsulfonylmethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55948380 |
| Molecular Formula | C23H24N2O5S2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 3-[(4-methylphenyl)sulfamoyl]-N-[[4-(methylsulfonylmethyl)phenyl]methyl]benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cccc(C(=O)NCc3ccc(CS(C)(=O)=O)cc3)c2)cc1 |
| InChI | InChI=1S/C23H24N2O5S2/c1-17-6-12-21(13-7-17)25-32(29,30)22-5-3-4-20(14-22)23(26)24-15-18-8-10-19(11-9-18)16-31(2,27)28/h3-14,25H,15-16H2,1-2H3,(H,24,26) |
| InChIKey | WXNMSELZHRYURD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |