C22H22N2O5S2 — CID 55947241
4-(benzenesulfonamido)-N-[[4-(methylsulfonylmethyl)phenyl]methyl]benzamide (PubChem CID 55947241) has the molecular formula C22H22N2O5S2 and a molecular weight of 458.56 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-[[4-(methylsulfonylmethyl)phenyl]methyl]benzamide.
| Compound Name | 4-(benzenesulfonamido)-N-[[4-(methylsulfonylmethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55947241 |
| Molecular Formula | C22H22N2O5S2 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 4-(benzenesulfonamido)-N-[[4-(methylsulfonylmethyl)phenyl]methyl]benzamide |
| SMILES | CS(=O)(=O)Cc1ccc(CNC(=O)c2ccc(NS(=O)(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C22H22N2O5S2/c1-30(26,27)16-18-9-7-17(8-10-18)15-23-22(25)19-11-13-20(14-12-19)24-31(28,29)21-5-3-2-4-6-21/h2-14,24H,15-16H2,1H3,(H,23,25) |
| InChIKey | ZBBSCHPUBKWQRB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |