C18H15ClN2O3S2 — CID 32831454
4-(benzenesulfonamido)-N-[(5-chlorothiophen-2-yl)methyl]benzamide (PubChem CID 32831454) has the molecular formula C18H15ClN2O3S2 and a molecular weight of 406.92 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-[(5-chlorothiophen-2-yl)methyl]benzamide.
| Compound Name | 4-(benzenesulfonamido)-N-[(5-chlorothiophen-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 32831454 |
| Molecular Formula | C18H15ClN2O3S2 |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | 4-(benzenesulfonamido)-N-[(5-chlorothiophen-2-yl)methyl]benzamide |
| SMILES | O=C(NCc1ccc(Cl)s1)c1ccc(NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15ClN2O3S2/c19-17-11-10-15(25-17)12-20-18(22)13-6-8-14(9-7-13)21-26(23,24)16-4-2-1-3-5-16/h1-11,21H,12H2,(H,20,22) |
| InChIKey | YBXDDDPOVYVBIN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |