C20H18Cl2N2O4S2 — CID 32833050
2-chloro-N-[(5-chlorothiophen-2-yl)methyl]-5-[(4-ethoxyphenyl)sulfamoyl]benzamide (PubChem CID 32833050) has the molecular formula C20H18Cl2N2O4S2 and a molecular weight of 485.41 g/mol. Its IUPAC name is 2-chloro-N-[(5-chlorothiophen-2-yl)methyl]-5-[(4-ethoxyphenyl)sulfamoyl]benzamide.
| Compound Name | 2-chloro-N-[(5-chlorothiophen-2-yl)methyl]-5-[(4-ethoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 32833050 |
| Molecular Formula | C20H18Cl2N2O4S2 |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 484.01 |
| IUPAC Name | 2-chloro-N-[(5-chlorothiophen-2-yl)methyl]-5-[(4-ethoxyphenyl)sulfamoyl]benzamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(Cl)c(C(=O)NCc3ccc(Cl)s3)c2)cc1 |
| InChI | InChI=1S/C20H18Cl2N2O4S2/c1-2-28-14-5-3-13(4-6-14)24-30(26,27)16-8-9-18(21)17(11-16)20(25)23-12-15-7-10-19(22)29-15/h3-11,24H,2,12H2,1H3,(H,23,25) |
| InChIKey | XRFIGIWKADHBCR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |