C21H21ClN4O4S — CID 55370337
2-chloro-N,N-bis(2-cyanoethyl)-5-[(4-ethoxyphenyl)sulfamoyl]benzamide (PubChem CID 55370337) has the molecular formula C21H21ClN4O4S and a molecular weight of 460.94 g/mol. Its IUPAC name is 2-chloro-N,N-bis(2-cyanoethyl)-5-[(4-ethoxyphenyl)sulfamoyl]benzamide.
| Compound Name | 2-chloro-N,N-bis(2-cyanoethyl)-5-[(4-ethoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55370337 |
| Molecular Formula | C21H21ClN4O4S |
| Molecular Weight | 460.94 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 2-chloro-N,N-bis(2-cyanoethyl)-5-[(4-ethoxyphenyl)sulfamoyl]benzamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(Cl)c(C(=O)N(CCC#N)CCC#N)c2)cc1 |
| InChI | InChI=1S/C21H21ClN4O4S/c1-2-30-17-7-5-16(6-8-17)25-31(28,29)18-9-10-20(22)19(15-18)21(27)26(13-3-11-23)14-4-12-24/h5-10,15,25H,2-4,13-14H2,1H3 |
| InChIKey | NAZBYDBUUVYSRV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.94 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |