C24H22FN3O4S — CID 2344487
N-(2-cyanoethyl)-4-[(4-ethoxyphenyl)sulfonylamino]-N-(4-fluorophenyl)benzamide (PubChem CID 2344487) has the molecular formula C24H22FN3O4S and a molecular weight of 467.52 g/mol. Its IUPAC name is N-(2-cyanoethyl)-4-[(4-ethoxyphenyl)sulfonylamino]-N-(4-fluorophenyl)benzamide.
| Compound Name | N-(2-cyanoethyl)-4-[(4-ethoxyphenyl)sulfonylamino]-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 2344487 |
| Molecular Formula | C24H22FN3O4S |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | N-(2-cyanoethyl)-4-[(4-ethoxyphenyl)sulfonylamino]-N-(4-fluorophenyl)benzamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(C(=O)N(CCC#N)c3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H22FN3O4S/c1-2-32-22-12-14-23(15-13-22)33(30,31)27-20-8-4-18(5-9-20)24(29)28(17-3-16-26)21-10-6-19(25)7-11-21/h4-15,27H,2-3,17H2,1H3 |
| InChIKey | WRBQSCDLFABPJE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |