C21H23N3O4S — CID 56534564
(E)-N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-3-[4-(methylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 56534564) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is (E)-N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-3-[4-(methylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-3-[4-(methylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 56534564 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | (E)-N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-3-[4-(methylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | CCOc1ccc(N(CCC#N)C(=O)/C=C/c2ccc(S(=O)(=O)NC)cc2)cc1 |
| InChI | InChI=1S/C21H23N3O4S/c1-3-28-19-10-8-18(9-11-19)24(16-4-15-22)21(25)14-7-17-5-12-20(13-6-17)29(26,27)23-2/h5-14,23H,3-4,16H2,1-2H3/b14-7+ |
| InChIKey | KMOHUOYEOUJHMN-VGOFMYFVSA-N |
| XLogP | 2.95 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|