C15H21NO2 — CID 73010710
3-(4-ethoxyphenyl)-N,N-diethylprop-2-enamide (PubChem CID 73010710) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-N,N-diethylprop-2-enamide.
| Compound Name | 3-(4-ethoxyphenyl)-N,N-diethylprop-2-enamide |
|---|---|
| PubChem CID | 73010710 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 3-(4-ethoxyphenyl)-N,N-diethylprop-2-enamide |
| SMILES | CCOc1ccc(C=CC(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C15H21NO2/c1-4-16(5-2)15(17)12-9-13-7-10-14(11-8-13)18-6-3/h7-12H,4-6H2,1-3H3 |
| InChIKey | HFUHFIVEACOPRF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|