C17H25NO3 — CID 110498588
(E)-3-[4-(methoxymethoxy)phenyl]-N,N-dipropylprop-2-enamide (PubChem CID 110498588) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is (E)-3-[4-(methoxymethoxy)phenyl]-N,N-dipropylprop-2-enamide.
| Compound Name | (E)-3-[4-(methoxymethoxy)phenyl]-N,N-dipropylprop-2-enamide |
|---|---|
| PubChem CID | 110498588 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (E)-3-[4-(methoxymethoxy)phenyl]-N,N-dipropylprop-2-enamide |
| SMILES | CCCN(CCC)C(=O)/C=C/c1ccc(OCOC)cc1 |
| InChI | InChI=1S/C17H25NO3/c1-4-12-18(13-5-2)17(19)11-8-15-6-9-16(10-7-15)21-14-20-3/h6-11H,4-5,12-14H2,1-3H3/b11-8+ |
| InChIKey | QZXCVDPFTHEPSG-DHZHZOJOSA-N |
| XLogP | 3.33 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|