C16H23NO2 — CID 3500968
3-(4-methoxyphenyl)-N,N-dipropylprop-2-enamide (PubChem CID 3500968) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N,N-dipropylprop-2-enamide.
| Compound Name | 3-(4-methoxyphenyl)-N,N-dipropylprop-2-enamide |
|---|---|
| PubChem CID | 3500968 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 3-(4-methoxyphenyl)-N,N-dipropylprop-2-enamide |
| SMILES | CCCN(CCC)C(=O)C=Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C16H23NO2/c1-4-12-17(13-5-2)16(18)11-8-14-6-9-15(19-3)10-7-14/h6-11H,4-5,12-13H2,1-3H3 |
| InChIKey | AUBFOYPXXQGRLA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|