C14H18O3 — CID 53421003
butyl 3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 53421003) has the molecular formula C14H18O3 and a molecular weight of 234.30 g/mol. Its IUPAC name is butyl 3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | butyl 3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 53421003 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | butyl 3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | CCCCOC(=O)C=Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C14H18O3/c1-3-4-11-17-14(15)10-7-12-5-8-13(16-2)9-6-12/h5-10H,3-4,11H2,1-2H3 |
| InChIKey | QGHSAIVADXXKSX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|