About 6-methylheptyl (E)-3-(4-methoxyphenyl)prop-2-enoate
6-methylheptyl (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 22341896) has the molecular formula C18H26O3
and a molecular weight of 290.40 g/mol. Its IUPAC name is 6-methylheptyl (E)-3-(4-methoxyphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | 6-methylheptyl (E)-3-(4-methoxyphenyl)prop-2-enoate |
| PubChem CID | 22341896 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 6-methylheptyl (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCCCCCC(C)C)cc1 |
| InChI | InChI=1S/C18H26O3/c1-15(2)7-5-4-6-14-21-18(19)13-10-16-8-11-17(20-3)12-9-16/h8-13,15H,4-7,14H2,1-3H3/b13-10+ |
| InChIKey | FQTSQICZRGKPEQ-JLHYYAGUSA-N |
| XLogP | 4.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-methylheptyl (E)-3-(4-methoxyphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylheptyl (E)-3-(4-methoxyphenyl)prop-2-enoate?
The IUPAC name of 6-methylheptyl (E)-3-(4-methoxyphenyl)prop-2-enoate (CID 22341896) is 6-methylheptyl (E)-3-(4-methoxyphenyl)prop-2-enoate.
What is the SMILES notation for 6-methylheptyl (E)-3-(4-methoxyphenyl)prop-2-enoate?
The canonical SMILES for 6-methylheptyl (E)-3-(4-methoxyphenyl)prop-2-enoate is COc1ccc(/C=C/C(=O)OCCCCCC(C)C)cc1.
What is the InChIKey of 6-methylheptyl (E)-3-(4-methoxyphenyl)prop-2-enoate?
The InChIKey is FQTSQICZRGKPEQ-JLHYYAGUSA-N. The full InChI is InChI=1S/C18H26O3/c1-15(2)7-5-4-6-14-21-18(19)13-10-16-8-11-17(20-3)12-9-16/h8-13,15H,4-7,14H2,1-3H3/b13-10+.
What are the key properties of 6-methylheptyl (E)-3-(4-methoxyphenyl)prop-2-enoate?
6-methylheptyl (E)-3-(4-methoxyphenyl)prop-2-enoate has a molecular weight of 290.40 g/mol, XLogP of 4.47, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylheptyl (E)-3-(4-methoxyphenyl)prop-2-enoate is sourced from PubChem (CID 22341896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).