C22H24O3 — CID 56950890
butyl (E)-3-[4-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]prop-2-enoate (PubChem CID 56950890) has the molecular formula C22H24O3 and a molecular weight of 336.43 g/mol. Its IUPAC name is butyl (E)-3-[4-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]prop-2-enoate.
| Compound Name | butyl (E)-3-[4-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 56950890 |
| Molecular Formula | C22H24O3 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | butyl (E)-3-[4-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]prop-2-enoate |
| SMILES | CCCCOC(=O)/C=C/c1ccc(/C=C/c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H24O3/c1-3-4-17-25-22(23)16-13-19-8-5-18(6-9-19)7-10-20-11-14-21(24-2)15-12-20/h5-16H,3-4,17H2,1-2H3/b10-7+,16-13+ |
| InChIKey | STQNNVFWJPHYJJ-NJKRNUQASA-N |
| XLogP | 5.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|