C13H18ClNO3 — CID 175106666
3-aminopropyl (E)-3-(4-methoxyphenyl)prop-2-enoate;hydrochloride (PubChem CID 175106666) has the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. Its IUPAC name is 3-aminopropyl (E)-3-(4-methoxyphenyl)prop-2-enoate;hydrochloride.
| Compound Name | 3-aminopropyl (E)-3-(4-methoxyphenyl)prop-2-enoate;hydrochloride |
|---|---|
| PubChem CID | 175106666 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 3-aminopropyl (E)-3-(4-methoxyphenyl)prop-2-enoate;hydrochloride |
| SMILES | COc1ccc(/C=C/C(=O)OCCCN)cc1.Cl |
| InChI | InChI=1S/C13H17NO3.ClH/c1-16-12-6-3-11(4-7-12)5-8-13(15)17-10-2-9-14;/h3-8H,2,9-10,14H2,1H3;1H/b8-5+; |
| InChIKey | FNXULBHPQDMFHB-HAAWTFQLSA-N |
| XLogP | 2.02 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|